C12H19NSY — CID 142822248
N-[(2,4-dimethylphenyl)methyl]-N-propylthiohydroxylamine;yttrium (PubChem CID 142822248) has the molecular formula C12H19NSY and a molecular weight of 298.26 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-N-propylthiohydroxylamine;yttrium.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-N-propylthiohydroxylamine;yttrium |
|---|---|
| PubChem CID | 142822248 |
| Molecular Formula | C12H19NSY |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-N-propylthiohydroxylamine;yttrium |
| SMILES | CCCN(S)Cc1ccc(C)cc1C.[Y] |
| InChI | InChI=1S/C12H19NS.Y/c1-4-7-13(14)9-12-6-5-10(2)8-11(12)3;/h5-6,8,14H,4,7,9H2,1-3H3; |
| InChIKey | NZIPRDLISOQNIH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|