C21H38ClP — CID 3056479
tributyl-[(2,4-dimethylphenyl)methyl]phosphanium chloride (PubChem CID 3056479) has the molecular formula C21H38ClP and a molecular weight of 356.96 g/mol. Its IUPAC name is tributyl-[(2,4-dimethylphenyl)methyl]phosphanium chloride.
| Compound Name | tributyl-[(2,4-dimethylphenyl)methyl]phosphanium chloride |
|---|---|
| PubChem CID | 3056479 |
| Molecular Formula | C21H38ClP |
| Molecular Weight | 356.96 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | tributyl-[(2,4-dimethylphenyl)methyl]phosphanium chloride |
| SMILES | CCCC[P+](CCCC)(CCCC)Cc1ccc(C)cc1C.[Cl-] |
| InChI | InChI=1S/C21H38P.ClH/c1-6-9-14-22(15-10-7-2,16-11-8-3)18-21-13-12-19(4)17-20(21)5;/h12-13,17H,6-11,14-16,18H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | QNLYPUWNUUWWCD-UHFFFAOYSA-M |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|