C22H29ClO4 — CID 142828272
(3Z,3aR,6aR)-3-[(3-chlorophenyl)methylidene]-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione;nonane (PubChem CID 142828272) has the molecular formula C22H29ClO4 and a molecular weight of 392.92 g/mol. Its IUPAC name is (3Z,3aR,6aR)-3-[(3-chlorophenyl)methylidene]-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione;nonane.
| Compound Name | (3Z,3aR,6aR)-3-[(3-chlorophenyl)methylidene]-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione;nonane |
|---|---|
| PubChem CID | 142828272 |
| Molecular Formula | C22H29ClO4 |
| Molecular Weight | 392.92 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (3Z,3aR,6aR)-3-[(3-chlorophenyl)methylidene]-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione;nonane |
| SMILES | CCCCCCCCC.O=C1O[C@H]2C(=O)OC[C@H]2/C1=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H9ClO4.C9H20/c14-8-3-1-2-7(4-8)5-9-10-6-17-13(16)11(10)18-12(9)15;1-3-5-7-9-8-6-4-2/h1-5,10-11H,6H2;3-9H2,1-2H3/b9-5-;/t10-,11+;/m0./s1 |
| InChIKey | YEEQTVILGZGFPF-VUAMZKITSA-N |
| XLogP | 5.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.92 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|