C34H38 — CID 142828430
9,10-dimethyl-2-[(1E,3E)-4-[(6E)-5-methylidene-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]buta-1,3-dienyl]anthracene;ethane (PubChem CID 142828430) has the molecular formula C34H38 and a molecular weight of 446.68 g/mol. Its IUPAC name is 9,10-dimethyl-2-[(1E,3E)-4-[(6E)-5-methylidene-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]buta-1,3-dienyl]anthracene;ethane.
| Compound Name | 9,10-dimethyl-2-[(1E,3E)-4-[(6E)-5-methylidene-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]buta-1,3-dienyl]anthracene;ethane |
|---|---|
| PubChem CID | 142828430 |
| Molecular Formula | C34H38 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 9,10-dimethyl-2-[(1E,3E)-4-[(6E)-5-methylidene-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]buta-1,3-dienyl]anthracene;ethane |
| SMILES | C=C/C=c1/c(/C=C/C=C/c2ccc3c(C)c4ccccc4c(C)c3c2)cccc1=C.CC.CC |
| InChI | InChI=1S/C30H26.2C2H6/c1-5-11-26-21(2)12-10-15-25(26)14-7-6-13-24-18-19-29-22(3)27-16-8-9-17-28(27)23(4)30(29)20-24;2*1-2/h5-20H,1-2H2,3-4H3;2*1-2H3/b13-6+,14-7+,26-11+;; |
| InChIKey | YEDKMYAUJPVEPK-JCKNZBISSA-N |
| XLogP | 8.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|