C17H16F2N2 — CID 142836054
(2E,4E,6E)-4-ethenyl-7-fluoro-1-(4-fluoro-3-methanimidoylphenyl)octa-2,4,6-trien-1-imine (PubChem CID 142836054) has the molecular formula C17H16F2N2 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2E,4E,6E)-4-ethenyl-7-fluoro-1-(4-fluoro-3-methanimidoylphenyl)octa-2,4,6-trien-1-imine.
| Compound Name | (2E,4E,6E)-4-ethenyl-7-fluoro-1-(4-fluoro-3-methanimidoylphenyl)octa-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 142836054 |
| Molecular Formula | C17H16F2N2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (2E,4E,6E)-4-ethenyl-7-fluoro-1-(4-fluoro-3-methanimidoylphenyl)octa-2,4,6-trien-1-imine |
| SMILES | [H]/N=C/c1cc(C(/C=C/C(C=C)=C/C=C(\C)F)=N/[H])ccc1F |
| InChI | InChI=1S/C17H16F2N2/c1-3-13(5-4-12(2)18)6-9-17(21)14-7-8-16(19)15(10-14)11-20/h3-11,20-21H,1H2,2H3/b9-6+,12-4+,13-5+,20-11+,21-17+ |
| InChIKey | PYNYNPATNDOAEC-HDSDHHABSA-N |
| XLogP | 4.73 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|