C21H31NO — CID 142840934
1-[(E)-3-methylpent-3-enyl]-5-(4-phenylpentyl)pyrrolidin-2-one (PubChem CID 142840934) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-[(E)-3-methylpent-3-enyl]-5-(4-phenylpentyl)pyrrolidin-2-one.
| Compound Name | 1-[(E)-3-methylpent-3-enyl]-5-(4-phenylpentyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 142840934 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 1-[(E)-3-methylpent-3-enyl]-5-(4-phenylpentyl)pyrrolidin-2-one |
| SMILES | C/C=C(\C)CCN1C(=O)CCC1CCCC(C)c1ccccc1 |
| InChI | InChI=1S/C21H31NO/c1-4-17(2)15-16-22-20(13-14-21(22)23)12-8-9-18(3)19-10-6-5-7-11-19/h4-7,10-11,18,20H,8-9,12-16H2,1-3H3/b17-4+ |
| InChIKey | LWBTYKKAKCZVIH-HAVNEIBRSA-N |
| XLogP | 5.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|