About ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium
ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium (PubChem CID 142844874) has the molecular formula C19H40V
and a molecular weight of 319.47 g/mol. Its IUPAC name is ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium.
Molecular Properties
| Compound Name | ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium |
| PubChem CID | 142844874 |
| Molecular Formula | C19H40V |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium |
| SMILES | C/C=C\CC(CCC)C(=C(C)C)C(C)C.CC.CC.[V] |
| InChI | InChI=1S/C15H28.2C2H6.V/c1-7-9-11-14(10-8-2)15(12(3)4)13(5)6;2*1-2;/h7,9,12,14H,8,10-11H2,1-6H3;2*1-2H3;/b9-7-;;; |
| InChIKey | GCLBONUUAUXMGV-AXXLBGQXSA-N |
| XLogP | 7.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium?
The IUPAC name of ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium (CID 142844874) is ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium.
What is the SMILES notation for ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium?
The canonical SMILES for ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium is C/C=C\CC(CCC)C(=C(C)C)C(C)C.CC.CC.[V].
What is the InChIKey of ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium?
The InChIKey is GCLBONUUAUXMGV-AXXLBGQXSA-N. The full InChI is InChI=1S/C15H28.2C2H6.V/c1-7-9-11-14(10-8-2)15(12(3)4)13(5)6;2*1-2;/h7,9,12,14H,8,10-11H2,1-6H3;2*1-2H3;/b9-7-;;;.
What are the key properties of ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium?
ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium has a molecular weight of 319.47 g/mol, XLogP of 7.41, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium is sourced from PubChem (CID 142844874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).