C19H40V — CID 142844874
ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium (PubChem CID 142844874) has the molecular formula C19H40V and a molecular weight of 319.47 g/mol. Its IUPAC name is ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium.
| Compound Name | ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium |
|---|---|
| PubChem CID | 142844874 |
| Molecular Formula | C19H40V |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | ethane;(6Z)-2-methyl-3-propan-2-yl-4-propylocta-2,6-diene;vanadium |
| SMILES | C/C=C\CC(CCC)C(=C(C)C)C(C)C.CC.CC.[V] |
| InChI | InChI=1S/C15H28.2C2H6.V/c1-7-9-11-14(10-8-2)15(12(3)4)13(5)6;2*1-2;/h7,9,12,14H,8,10-11H2,1-6H3;2*1-2H3;/b9-7-;;; |
| InChIKey | GCLBONUUAUXMGV-AXXLBGQXSA-N |
| XLogP | 7.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|