C21H16F3N5O3 — CID 142847224
3-[[2-[4-[(methylideneamino)methyl]anilino]-5-(trifluoromethyl)phenyl]carbamoyl]pyrazine-2-carboxylic acid (PubChem CID 142847224) has the molecular formula C21H16F3N5O3 and a molecular weight of 443.39 g/mol. Its IUPAC name is 3-[[2-[4-[(methylideneamino)methyl]anilino]-5-(trifluoromethyl)phenyl]carbamoyl]pyrazine-2-carboxylic acid.
| Compound Name | 3-[[2-[4-[(methylideneamino)methyl]anilino]-5-(trifluoromethyl)phenyl]carbamoyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 142847224 |
| Molecular Formula | C21H16F3N5O3 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 3-[[2-[4-[(methylideneamino)methyl]anilino]-5-(trifluoromethyl)phenyl]carbamoyl]pyrazine-2-carboxylic acid |
| SMILES | C=NCc1ccc(Nc2ccc(C(F)(F)F)cc2NC(=O)c2nccnc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H16F3N5O3/c1-25-11-12-2-5-14(6-3-12)28-15-7-4-13(21(22,23)24)10-16(15)29-19(30)17-18(20(31)32)27-9-8-26-17/h2-10,28H,1,11H2,(H,29,30)(H,31,32) |
| InChIKey | NVWOJCPPXBILHI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|