C21H15Br4ClF3N3O4S — CID 87948716
[4-[2-[(2,3,4,5-tetrabromo-6-sulfobenzoyl)amino]-4-(trifluoromethyl)anilino]phenyl]methylazanium chloride (PubChem CID 87948716) has the molecular formula C21H15Br4ClF3N3O4S and a molecular weight of 817.50 g/mol. Its IUPAC name is [4-[2-[(2,3,4,5-tetrabromo-6-sulfobenzoyl)amino]-4-(trifluoromethyl)anilino]phenyl]methylazanium chloride.
| Compound Name | [4-[2-[(2,3,4,5-tetrabromo-6-sulfobenzoyl)amino]-4-(trifluoromethyl)anilino]phenyl]methylazanium chloride |
|---|---|
| PubChem CID | 87948716 |
| Molecular Formula | C21H15Br4ClF3N3O4S |
| Molecular Weight | 817.50 g/mol |
| Exact Mass | 812.72 |
| IUPAC Name | [4-[2-[(2,3,4,5-tetrabromo-6-sulfobenzoyl)amino]-4-(trifluoromethyl)anilino]phenyl]methylazanium chloride |
| SMILES | [Cl-].[NH3+]Cc1ccc(Nc2ccc(C(F)(F)F)cc2NC(=O)c2c(Br)c(Br)c(Br)c(Br)c2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C21H14Br4F3N3O4S.ClH/c22-15-14(19(36(33,34)35)18(25)17(24)16(15)23)20(32)31-13-7-10(21(26,27)28)3-6-12(13)30-11-4-1-9(8-29)2-5-11;/h1-7,30H,8,29H2,(H,31,32)(H,33,34,35);1H |
| InChIKey | CNPQFSUTGXJRBH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|