C43H36O11P2 — CID 142850241
[2-[2-bis(2-formylphenoxy)phosphanyloxybenzoyl]phenyl] (2-formylphenyl) 4-oxobut-1-en-2-yl phosphite;(3Z)-penta-1,3-diene (PubChem CID 142850241) has the molecular formula C43H36O11P2 and a molecular weight of 790.70 g/mol. Its IUPAC name is [2-[2-bis(2-formylphenoxy)phosphanyloxybenzoyl]phenyl] (2-formylphenyl) 4-oxobut-1-en-2-yl phosphite;(3Z)-penta-1,3-diene.
| Compound Name | [2-[2-bis(2-formylphenoxy)phosphanyloxybenzoyl]phenyl] (2-formylphenyl) 4-oxobut-1-en-2-yl phosphite;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 142850241 |
| Molecular Formula | C43H36O11P2 |
| Molecular Weight | 790.70 g/mol |
| Exact Mass | 790.17 |
| IUPAC Name | [2-[2-bis(2-formylphenoxy)phosphanyloxybenzoyl]phenyl] (2-formylphenyl) 4-oxobut-1-en-2-yl phosphite;(3Z)-penta-1,3-diene |
| SMILES | C=C(CC=O)OP(Oc1ccccc1C=O)Oc1ccccc1C(=O)c1ccccc1OP(Oc1ccccc1C=O)Oc1ccccc1C=O.C=C/C=C\C |
| InChI | InChI=1S/C38H28O11P2.C5H8/c1-27(22-23-39)44-50(45-33-17-7-2-12-28(33)24-40)48-36-20-10-5-15-31(36)38(43)32-16-6-11-21-37(32)49-51(46-34-18-8-3-13-29(34)25-41)47-35-19-9-4-14-30(35)26-42;1-3-5-4-2/h2-21,23-26H,1,22H2;3-5H,1H2,2H3/b;5-4- |
| InChIKey | GPSSYWXWDMRSNE-GUHKXDMSSA-N |
| XLogP | 10.67 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.70 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|