C22H25ClFN5O4 — CID 142852522
2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]-3-fluorophenol;1,4-dimethylpiperazin-2-one (PubChem CID 142852522) has the molecular formula C22H25ClFN5O4 and a molecular weight of 477.92 g/mol. Its IUPAC name is 2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]-3-fluorophenol;1,4-dimethylpiperazin-2-one.
| Compound Name | 2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]-3-fluorophenol;1,4-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 142852522 |
| Molecular Formula | C22H25ClFN5O4 |
| Molecular Weight | 477.92 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]-3-fluorophenol;1,4-dimethylpiperazin-2-one |
| SMILES | CN1CCN(C)C(=O)C1.COc1cc2ncnc(Nc3ccc(O)c(Cl)c3F)c2cc1OC |
| InChI | InChI=1S/C16H13ClFN3O3.C6H12N2O/c1-23-12-5-8-10(6-13(12)24-2)19-7-20-16(8)21-9-3-4-11(22)14(17)15(9)18;1-7-3-4-8(2)6(9)5-7/h3-7,22H,1-2H3,(H,19,20,21);3-5H2,1-2H3 |
| InChIKey | FPEZKXJJJZPXLU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.92 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|