C28H22N4O2S2 — CID 142860552
(5Z)-3-benzyl-2-(8-hydroxyquinolin-5-yl)imino-5-(4-methyl-3H-1,4-benzothiazin-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 142860552) has the molecular formula C28H22N4O2S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is (5Z)-3-benzyl-2-(8-hydroxyquinolin-5-yl)imino-5-(4-methyl-3H-1,4-benzothiazin-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-2-(8-hydroxyquinolin-5-yl)imino-5-(4-methyl-3H-1,4-benzothiazin-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142860552 |
| Molecular Formula | C28H22N4O2S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | (5Z)-3-benzyl-2-(8-hydroxyquinolin-5-yl)imino-5-(4-methyl-3H-1,4-benzothiazin-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CN1C/C(=C2/S/C(=N\c3ccc(O)c4ncccc34)N(Cc3ccccc3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C28H22N4O2S2/c1-31-17-24(35-23-12-6-5-11-21(23)31)26-27(34)32(16-18-8-3-2-4-9-18)28(36-26)30-20-13-14-22(33)25-19(20)10-7-15-29-25/h2-15,33H,16-17H2,1H3/b26-24-,30-28- |
| InChIKey | SHSBMCVRIJBXCA-ZFWUUWRMSA-N |
| XLogP | 6.16 |
| TPSA | 69.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|