C29H38N2O6 — CID 142864742
1-[5-methoxy-2-[(E)-1-[5-methoxy-2-(methylideneamino)-4-(5-morpholin-4-ylpentoxy)phenyl]prop-1-enoxy]phenyl]ethanone (PubChem CID 142864742) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is 1-[5-methoxy-2-[(E)-1-[5-methoxy-2-(methylideneamino)-4-(5-morpholin-4-ylpentoxy)phenyl]prop-1-enoxy]phenyl]ethanone.
| Compound Name | 1-[5-methoxy-2-[(E)-1-[5-methoxy-2-(methylideneamino)-4-(5-morpholin-4-ylpentoxy)phenyl]prop-1-enoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 142864742 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 1-[5-methoxy-2-[(E)-1-[5-methoxy-2-(methylideneamino)-4-(5-morpholin-4-ylpentoxy)phenyl]prop-1-enoxy]phenyl]ethanone |
| SMILES | C=Nc1cc(OCCCCCN2CCOCC2)c(OC)cc1/C(=C\C)Oc1ccc(OC)cc1C(C)=O |
| InChI | InChI=1S/C29H38N2O6/c1-6-26(37-27-11-10-22(33-4)18-23(27)21(2)32)24-19-28(34-5)29(20-25(24)30-3)36-15-9-7-8-12-31-13-16-35-17-14-31/h6,10-11,18-20H,3,7-9,12-17H2,1-2,4-5H3/b26-6+ |
| InChIKey | ISWWDVSBPHSGOH-GOTRBWPWSA-N |
| XLogP | 5.56 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|