C25H30ClN3O5 — CID 166930794
3-chloro-4-[(E)-1-[6-(methylideneamino)-8-(3-morpholin-4-ylpropoxy)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-1-enoxy]aniline (PubChem CID 166930794) has the molecular formula C25H30ClN3O5 and a molecular weight of 487.98 g/mol. Its IUPAC name is 3-chloro-4-[(E)-1-[6-(methylideneamino)-8-(3-morpholin-4-ylpropoxy)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-1-enoxy]aniline.
| Compound Name | 3-chloro-4-[(E)-1-[6-(methylideneamino)-8-(3-morpholin-4-ylpropoxy)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-1-enoxy]aniline |
|---|---|
| PubChem CID | 166930794 |
| Molecular Formula | C25H30ClN3O5 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 3-chloro-4-[(E)-1-[6-(methylideneamino)-8-(3-morpholin-4-ylpropoxy)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-1-enoxy]aniline |
| SMILES | C=Nc1cc(OCCCN2CCOCC2)c2c(c1/C(=C\C)Oc1ccc(N)cc1Cl)OCCO2 |
| InChI | InChI=1S/C25H30ClN3O5/c1-3-20(34-21-6-5-17(27)15-18(21)26)23-19(28-2)16-22(24-25(23)33-14-13-32-24)31-10-4-7-29-8-11-30-12-9-29/h3,5-6,15-16H,2,4,7-14,27H2,1H3/b20-3+ |
| InChIKey | YZWDSZNHFUNHGJ-BIMFAAKUSA-N |
| XLogP | 4.57 |
| TPSA | 87.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|