C9H15F — CID 142867206
4-ethyl-5-fluoro-1,3-dimethylcyclopentene (PubChem CID 142867206) has the molecular formula C9H15F and a molecular weight of 142.22 g/mol. Its IUPAC name is 4-ethyl-5-fluoro-1,3-dimethylcyclopentene.
| Compound Name | 4-ethyl-5-fluoro-1,3-dimethylcyclopentene |
|---|---|
| PubChem CID | 142867206 |
| Molecular Formula | C9H15F |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 4-ethyl-5-fluoro-1,3-dimethylcyclopentene |
| SMILES | CCC1C(C)C=C(C)C1F |
| InChI | InChI=1S/C9H15F/c1-4-8-6(2)5-7(3)9(8)10/h5-6,8-9H,4H2,1-3H3 |
| InChIKey | PLLZHKBOHLWLND-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|