C12H20 — CID 123748890
6-ethyl-1,2,3,5-tetramethylcyclohexa-1,3-diene (PubChem CID 123748890) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 6-ethyl-1,2,3,5-tetramethylcyclohexa-1,3-diene.
| Compound Name | 6-ethyl-1,2,3,5-tetramethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123748890 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 6-ethyl-1,2,3,5-tetramethylcyclohexa-1,3-diene |
| SMILES | CCC1C(C)=C(C)C(C)=CC1C |
| InChI | InChI=1S/C12H20/c1-6-12-9(3)7-8(2)10(4)11(12)5/h7,9,12H,6H2,1-5H3 |
| InChIKey | VFWSLSFOWVMEOL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |