C14H24 — CID 123196289
6-butyl-1,2,3,5-tetramethylcyclohexa-1,3-diene (PubChem CID 123196289) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 6-butyl-1,2,3,5-tetramethylcyclohexa-1,3-diene.
| Compound Name | 6-butyl-1,2,3,5-tetramethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123196289 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 6-butyl-1,2,3,5-tetramethylcyclohexa-1,3-diene |
| SMILES | CCCCC1C(C)=C(C)C(C)=CC1C |
| InChI | InChI=1S/C14H24/c1-6-7-8-14-11(3)9-10(2)12(4)13(14)5/h9,11,14H,6-8H2,1-5H3 |
| InChIKey | OEACHOUGUGDILH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |