C28H23N3 — CID 142877434
N-[5-(cyclohepta-1,4,6-trien-1-ylmethyl)pyrazolo[1,5-a]pyridin-7-yl]-1,1-diphenylmethanimine (PubChem CID 142877434) has the molecular formula C28H23N3 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[5-(cyclohepta-1,4,6-trien-1-ylmethyl)pyrazolo[1,5-a]pyridin-7-yl]-1,1-diphenylmethanimine.
| Compound Name | N-[5-(cyclohepta-1,4,6-trien-1-ylmethyl)pyrazolo[1,5-a]pyridin-7-yl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 142877434 |
| Molecular Formula | C28H23N3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[5-(cyclohepta-1,4,6-trien-1-ylmethyl)pyrazolo[1,5-a]pyridin-7-yl]-1,1-diphenylmethanimine |
| SMILES | C1=CCC=C(Cc2cc(N=C(c3ccccc3)c3ccccc3)n3nccc3c2)C=C1 |
| InChI | InChI=1S/C28H23N3/c1-2-6-12-22(11-5-1)19-23-20-26-17-18-29-31(26)27(21-23)30-28(24-13-7-3-8-14-24)25-15-9-4-10-16-25/h1-5,7-18,20-21H,6,19H2 |
| InChIKey | UCKNXCCEMZWNII-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|