C12H14N6O6S3 — CID 142883714
4-[[4-[amino-[(5-methylfuran-2-yl)methyl]amino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-3-hydroxythiophene-2-sulfonamide (PubChem CID 142883714) has the molecular formula C12H14N6O6S3 and a molecular weight of 434.48 g/mol. Its IUPAC name is 4-[[4-[amino-[(5-methylfuran-2-yl)methyl]amino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-3-hydroxythiophene-2-sulfonamide.
| Compound Name | 4-[[4-[amino-[(5-methylfuran-2-yl)methyl]amino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-3-hydroxythiophene-2-sulfonamide |
|---|---|
| PubChem CID | 142883714 |
| Molecular Formula | C12H14N6O6S3 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 4-[[4-[amino-[(5-methylfuran-2-yl)methyl]amino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-3-hydroxythiophene-2-sulfonamide |
| SMILES | Cc1ccc(CN(N)C2=NS(=O)(=O)N=C2Nc2csc(S(N)(=O)=O)c2O)o1 |
| InChI | InChI=1S/C12H14N6O6S3/c1-6-2-3-7(24-6)4-18(13)11-10(16-27(22,23)17-11)15-8-5-25-12(9(8)19)26(14,20)21/h2-3,5,19H,4,13H2,1H3,(H,15,16)(H2,14,20,21) |
| InChIKey | HCFFJQYVNQIKAD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 193.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|