C37H42N4 — CID 142885103
1-[4-(2-cyclohepta-1,3,5-trien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-2,3-dimethyl-4,5,6,7-tetrahydroindole;ethane;ethenamine (PubChem CID 142885103) has the molecular formula C37H42N4 and a molecular weight of 542.77 g/mol. Its IUPAC name is 1-[4-(2-cyclohepta-1,3,5-trien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-2,3-dimethyl-4,5,6,7-tetrahydroindole;ethane;ethenamine.
| Compound Name | 1-[4-(2-cyclohepta-1,3,5-trien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-2,3-dimethyl-4,5,6,7-tetrahydroindole;ethane;ethenamine |
|---|---|
| PubChem CID | 142885103 |
| Molecular Formula | C37H42N4 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 1-[4-(2-cyclohepta-1,3,5-trien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-2,3-dimethyl-4,5,6,7-tetrahydroindole;ethane;ethenamine |
| SMILES | C=CN.CC.Cc1c2c(n(-c3ccc(-c4cc(-c5ccccc5)nc(C5=CC=CC=CC5)n4)cc3)c1C)CCCC2 |
| InChI | InChI=1S/C33H31N3.C2H5N.C2H6/c1-23-24(2)36(32-17-11-10-16-29(23)32)28-20-18-26(19-21-28)31-22-30(25-12-8-5-9-13-25)34-33(35-31)27-14-6-3-4-7-15-27;1-2-3;1-2/h3-9,12-14,18-22H,10-11,15-17H2,1-2H3;2H,1,3H2;1-2H3 |
| InChIKey | HQDGUEZBMQXJQS-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |