C51H57N3 — CID 142885135
4-(3-cyclohepta-1,3,5-trien-1-yl-5-phenylphenyl)-N-[(4Z)-5-ethylocta-4,7-dien-4-yl]-N-prop-2-enyl-6-(1,2,3,4-tetrahydrocarbazol-9-yl)pyridin-2-amine;ethane (PubChem CID 142885135) has the molecular formula C51H57N3 and a molecular weight of 712.04 g/mol. Its IUPAC name is 4-(3-cyclohepta-1,3,5-trien-1-yl-5-phenylphenyl)-N-[(4Z)-5-ethylocta-4,7-dien-4-yl]-N-prop-2-enyl-6-(1,2,3,4-tetrahydrocarbazol-9-yl)pyridin-2-amine;ethane.
| Compound Name | 4-(3-cyclohepta-1,3,5-trien-1-yl-5-phenylphenyl)-N-[(4Z)-5-ethylocta-4,7-dien-4-yl]-N-prop-2-enyl-6-(1,2,3,4-tetrahydrocarbazol-9-yl)pyridin-2-amine;ethane |
|---|---|
| PubChem CID | 142885135 |
| Molecular Formula | C51H57N3 |
| Molecular Weight | 712.04 g/mol |
| Exact Mass | 711.46 |
| IUPAC Name | 4-(3-cyclohepta-1,3,5-trien-1-yl-5-phenylphenyl)-N-[(4Z)-5-ethylocta-4,7-dien-4-yl]-N-prop-2-enyl-6-(1,2,3,4-tetrahydrocarbazol-9-yl)pyridin-2-amine;ethane |
| SMILES | C=CC/C(CC)=C(/CCC)N(CC=C)c1cc(-c2cc(C3=CC=CC=CC3)cc(-c3ccccc3)c2)cc(-n2c3c(c4ccccc42)CCCC3)n1.CC |
| InChI | InChI=1S/C49H51N3.C2H6/c1-5-20-36(8-4)45(21-6-2)51(30-7-3)48-34-42(35-49(50-48)52-46-28-18-16-26-43(46)44-27-17-19-29-47(44)52)41-32-39(37-22-12-9-10-13-23-37)31-40(33-41)38-24-14-11-15-25-38;1-2/h5,7,9-16,18,22,24-26,28,31-35H,1,3,6,8,17,19-21,23,27,29-30H2,2,4H3;1-2H3/b45-36-; |
| InChIKey | YVMVOSHKWODVQU-YFPIUZEZSA-N |
| XLogP | 14.20 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.04 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|