C24H21N3 — CID 144595905
4-[2-cyclohepta-1,3,5-trien-1-yl-6-(3-methylphenyl)pyrimidin-4-yl]aniline (PubChem CID 144595905) has the molecular formula C24H21N3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[2-cyclohepta-1,3,5-trien-1-yl-6-(3-methylphenyl)pyrimidin-4-yl]aniline.
| Compound Name | 4-[2-cyclohepta-1,3,5-trien-1-yl-6-(3-methylphenyl)pyrimidin-4-yl]aniline |
|---|---|
| PubChem CID | 144595905 |
| Molecular Formula | C24H21N3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-[2-cyclohepta-1,3,5-trien-1-yl-6-(3-methylphenyl)pyrimidin-4-yl]aniline |
| SMILES | Cc1cccc(-c2cc(-c3ccc(N)cc3)nc(C3=CC=CC=CC3)n2)c1 |
| InChI | InChI=1S/C24H21N3/c1-17-7-6-10-20(15-17)23-16-22(18-11-13-21(25)14-12-18)26-24(27-23)19-8-4-2-3-5-9-19/h2-8,10-16H,9,25H2,1H3 |
| InChIKey | MQLQZMXGDJUZFA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|