C28H29F6N5O5 — CID 142885566
[3,5-bis(trifluoromethyl)phenyl]methyl (6S)-3-(3-aminopropanoylamino)-8-benzyl-6-methyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 142885566) has the molecular formula C28H29F6N5O5 and a molecular weight of 629.56 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl (6S)-3-(3-aminopropanoylamino)-8-benzyl-6-methyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl (6S)-3-(3-aminopropanoylamino)-8-benzyl-6-methyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 142885566 |
| Molecular Formula | C28H29F6N5O5 |
| Molecular Weight | 629.56 g/mol |
| Exact Mass | 629.21 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl (6S)-3-(3-aminopropanoylamino)-8-benzyl-6-methyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | C[C@H]1C(=O)N(Cc2ccccc2)CC2N(C(=O)OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC(NC(=O)CCN)C(=O)N21 |
| InChI | InChI=1S/C28H29F6N5O5/c1-16-24(41)37(12-17-5-3-2-4-6-17)14-23-38(13-21(25(42)39(16)23)36-22(40)7-8-35)26(43)44-15-18-9-19(27(29,30)31)11-20(10-18)28(32,33)34/h2-6,9-11,16,21,23H,7-8,12-15,35H2,1H3,(H,36,40)/t16-,21?,23?/m0/s1 |
| InChIKey | VJHGQEGOWNWFFL-ULKQQTICSA-N |
| XLogP | 3.10 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |