C31H39F3N6O5 — CID 59678954
[3-methyl-5-(trifluoromethyl)phenyl]methyl (3S,6S,9aS)-6-(4-aminobutyl)-3-(3-aminopropanoylamino)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 59678954) has the molecular formula C31H39F3N6O5 and a molecular weight of 632.68 g/mol. Its IUPAC name is [3-methyl-5-(trifluoromethyl)phenyl]methyl (3S,6S,9aS)-6-(4-aminobutyl)-3-(3-aminopropanoylamino)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3-methyl-5-(trifluoromethyl)phenyl]methyl (3S,6S,9aS)-6-(4-aminobutyl)-3-(3-aminopropanoylamino)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 59678954 |
| Molecular Formula | C31H39F3N6O5 |
| Molecular Weight | 632.68 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | [3-methyl-5-(trifluoromethyl)phenyl]methyl (3S,6S,9aS)-6-(4-aminobutyl)-3-(3-aminopropanoylamino)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | Cc1cc(COC(=O)N2C[C@H](NC(=O)CCN)C(=O)N3[C@@H]2CN(Cc2ccccc2)C(=O)[C@@H]3CCCCN)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H39F3N6O5/c1-20-13-22(15-23(14-20)31(32,33)34)19-45-30(44)39-17-24(37-26(41)10-12-36)28(42)40-25(9-5-6-11-35)29(43)38(18-27(39)40)16-21-7-3-2-4-8-21/h2-4,7-8,13-15,24-25,27H,5-6,9-12,16-19,35-36H2,1H3,(H,37,41)/t24-,25-,27+/m0/s1 |
| InChIKey | YCGANCVCDKPTIU-OHSXHVKISA-N |
| XLogP | 2.49 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|