C33H41F3N4O5 — CID 59678960
[3-methyl-5-(trifluoromethyl)phenyl]methyl (3S,6S,9aS)-6-(4-aminobutyl)-3-benzyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 59678960) has the molecular formula C33H41F3N4O5 and a molecular weight of 630.71 g/mol. Its IUPAC name is [3-methyl-5-(trifluoromethyl)phenyl]methyl (3S,6S,9aS)-6-(4-aminobutyl)-3-benzyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3-methyl-5-(trifluoromethyl)phenyl]methyl (3S,6S,9aS)-6-(4-aminobutyl)-3-benzyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 59678960 |
| Molecular Formula | C33H41F3N4O5 |
| Molecular Weight | 630.71 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | [3-methyl-5-(trifluoromethyl)phenyl]methyl (3S,6S,9aS)-6-(4-aminobutyl)-3-benzyl-4,7-dioxo-8-(oxolan-2-ylmethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | Cc1cc(COC(=O)N2C[C@H](Cc3ccccc3)C(=O)N3[C@@H]2CN(CC2CCCO2)C(=O)[C@@H]3CCCCN)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H41F3N4O5/c1-22-14-24(17-26(15-22)33(34,35)36)21-45-32(43)39-18-25(16-23-8-3-2-4-9-23)30(41)40-28(11-5-6-12-37)31(42)38(20-29(39)40)19-27-10-7-13-44-27/h2-4,8-9,14-15,17,25,27-29H,5-7,10-13,16,18-21,37H2,1H3/t25-,27?,28-,29+/m0/s1 |
| InChIKey | NXADLZNSZQICAQ-YSYQBGJJSA-N |
| XLogP | 4.50 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|