C34H36F4N4O4 — CID 71121259
[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]methyl (6S)-6-(3-aminopropyl)-2,8-dibenzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 71121259) has the molecular formula C34H36F4N4O4 and a molecular weight of 640.68 g/mol. Its IUPAC name is [3-(fluoromethyl)-5-(trifluoromethyl)phenyl]methyl (6S)-6-(3-aminopropyl)-2,8-dibenzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3-(fluoromethyl)-5-(trifluoromethyl)phenyl]methyl (6S)-6-(3-aminopropyl)-2,8-dibenzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 71121259 |
| Molecular Formula | C34H36F4N4O4 |
| Molecular Weight | 640.68 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | [3-(fluoromethyl)-5-(trifluoromethyl)phenyl]methyl (6S)-6-(3-aminopropyl)-2,8-dibenzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | NCCC[C@H]1C(=O)N(Cc2ccccc2)CC2N(C(=O)OCc3cc(CF)cc(C(F)(F)F)c3)C(Cc3ccccc3)CC(=O)N21 |
| InChI | InChI=1S/C34H36F4N4O4/c35-19-25-14-26(16-27(15-25)34(36,37)38)22-46-33(45)41-28(17-23-8-3-1-4-9-23)18-31(43)42-29(12-7-13-39)32(44)40(21-30(41)42)20-24-10-5-2-6-11-24/h1-6,8-11,14-16,28-30H,7,12-13,17-22,39H2/t28?,29-,30?/m0/s1 |
| InChIKey | IKXYDINRPGWNDJ-GBYJYRDPSA-N |
| XLogP | 5.43 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.68 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |