C32H29F6N3O5 — CID 10100750
[3,5-bis(trifluoromethyl)phenyl]methyl (9aS)-2-benzyl-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 10100750) has the molecular formula C32H29F6N3O5 and a molecular weight of 649.59 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl (9aS)-2-benzyl-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl (9aS)-2-benzyl-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 10100750 |
| Molecular Formula | C32H29F6N3O5 |
| Molecular Weight | 649.59 g/mol |
| Exact Mass | 649.20 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl (9aS)-2-benzyl-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | COc1ccc(CN2C[C@H]3N(CC2=O)C(=O)CC(Cc2ccccc2)N3C(=O)OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C32H29F6N3O5/c1-45-26-9-7-21(8-10-26)16-39-17-27-40(18-29(39)43)28(42)15-25(13-20-5-3-2-4-6-20)41(27)30(44)46-19-22-11-23(31(33,34)35)14-24(12-22)32(36,37)38/h2-12,14,25,27H,13,15-19H2,1H3/t25?,27-/m0/s1 |
| InChIKey | ASQQBEDYQORTQU-GPNIZQGCSA-N |
| XLogP | 5.88 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |