C24H20ClF6N3O4 — CID 142885645
[3,5-bis(trifluoromethyl)phenyl]methyl 8-[(2-chlorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 142885645) has the molecular formula C24H20ClF6N3O4 and a molecular weight of 563.88 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl 8-[(2-chlorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl 8-[(2-chlorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 142885645 |
| Molecular Formula | C24H20ClF6N3O4 |
| Molecular Weight | 563.88 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl 8-[(2-chlorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | O=C1CN2C(=O)CCN(C(=O)OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2CN1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H20ClF6N3O4/c25-18-4-2-1-3-15(18)10-32-11-19-33(6-5-20(35)34(19)12-21(32)36)22(37)38-13-14-7-16(23(26,27)28)9-17(8-14)24(29,30)31/h1-4,7-9,19H,5-6,10-13H2 |
| InChIKey | CDQAZONLKWBJEJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.88 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |