C25H27F6N5O3 — CID 142885485
8-benzyl-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide;methanamine (PubChem CID 142885485) has the molecular formula C25H27F6N5O3 and a molecular weight of 559.51 g/mol. Its IUPAC name is 8-benzyl-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide;methanamine.
| Compound Name | 8-benzyl-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide;methanamine |
|---|---|
| PubChem CID | 142885485 |
| Molecular Formula | C25H27F6N5O3 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 8-benzyl-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide;methanamine |
| SMILES | CN.O=C1CN2C(=O)CCN(C(=O)NCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2CN1Cc1ccccc1 |
| InChI | InChI=1S/C24H22F6N4O3.CH5N/c25-23(26,27)17-8-16(9-18(10-17)24(28,29)30)11-31-22(37)33-7-6-20(35)34-14-21(36)32(13-19(33)34)12-15-4-2-1-3-5-15;1-2/h1-5,8-10,19H,6-7,11-14H2,(H,31,37);2H2,1H3 |
| InChIKey | QJEPGTWMYLMFAN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |