C22H28F3N3O5 — CID 142885828
(5Z,7E)-7-acetamido-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]deca-5,7-dienamide;ethene (PubChem CID 142885828) has the molecular formula C22H28F3N3O5 and a molecular weight of 471.48 g/mol. Its IUPAC name is (5Z,7E)-7-acetamido-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]deca-5,7-dienamide;ethene.
| Compound Name | (5Z,7E)-7-acetamido-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]deca-5,7-dienamide;ethene |
|---|---|
| PubChem CID | 142885828 |
| Molecular Formula | C22H28F3N3O5 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (5Z,7E)-7-acetamido-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]deca-5,7-dienamide;ethene |
| SMILES | C=C.CC/C=C(\C=C/CCC(C)(O)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1)NC(C)=O |
| InChI | InChI=1S/C20H24F3N3O5.C2H4/c1-4-7-14(24-13(2)27)8-5-6-11-19(3,29)18(28)25-15-9-10-17(26(30)31)16(12-15)20(21,22)23;1-2/h5,7-10,12,29H,4,6,11H2,1-3H3,(H,24,27)(H,25,28);1-2H2/b8-5-,14-7+; |
| InChIKey | ADXBEFYRFXPOBS-HRAZISOHSA-N |
| XLogP | 4.87 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|