C9H14O2 — CID 142888173
2-ethoxy-3-methylcyclohexa-1,5-dien-1-ol (PubChem CID 142888173) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-ethoxy-3-methylcyclohexa-1,5-dien-1-ol.
| Compound Name | 2-ethoxy-3-methylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 142888173 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-ethoxy-3-methylcyclohexa-1,5-dien-1-ol |
| SMILES | CCOC1=C(O)C=CCC1C |
| InChI | InChI=1S/C9H14O2/c1-3-11-9-7(2)5-4-6-8(9)10/h4,6-7,10H,3,5H2,1-2H3 |
| InChIKey | KDDFRHLDCRCEBR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |