About 7,8-difluoroquinoline-3-carbothialdehyde;ethane
7,8-difluoroquinoline-3-carbothialdehyde;ethane (PubChem CID 142890339) has the molecular formula C12H11F2NS
and a molecular weight of 239.29 g/mol. Its IUPAC name is 7,8-difluoroquinoline-3-carbothialdehyde;ethane.
Molecular Properties
| Compound Name | 7,8-difluoroquinoline-3-carbothialdehyde;ethane |
| PubChem CID | 142890339 |
| Molecular Formula | C12H11F2NS |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 7,8-difluoroquinoline-3-carbothialdehyde;ethane |
| SMILES | CC.Fc1ccc2cc(C=S)cnc2c1F |
| InChI | InChI=1S/C10H5F2NS.C2H6/c11-8-2-1-7-3-6(5-14)4-13-10(7)9(8)12;1-2/h1-5H;1-2H3 |
| InChIKey | YNUXMEHGRPRFAD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7,8-difluoroquinoline-3-carbothialdehyde;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoroquinoline-3-carbothialdehyde;ethane?
The IUPAC name of 7,8-difluoroquinoline-3-carbothialdehyde;ethane (CID 142890339) is 7,8-difluoroquinoline-3-carbothialdehyde;ethane.
What is the SMILES notation for 7,8-difluoroquinoline-3-carbothialdehyde;ethane?
The canonical SMILES for 7,8-difluoroquinoline-3-carbothialdehyde;ethane is CC.Fc1ccc2cc(C=S)cnc2c1F.
What is the InChIKey of 7,8-difluoroquinoline-3-carbothialdehyde;ethane?
The InChIKey is YNUXMEHGRPRFAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F2NS.C2H6/c11-8-2-1-7-3-6(5-14)4-13-10(7)9(8)12;1-2/h1-5H;1-2H3.
What are the key properties of 7,8-difluoroquinoline-3-carbothialdehyde;ethane?
7,8-difluoroquinoline-3-carbothialdehyde;ethane has a molecular weight of 239.29 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoroquinoline-3-carbothialdehyde;ethane is sourced from PubChem (CID 142890339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).