C20H18F4N2O — CID 138474823
N-(4,4-difluoro-2-methyl-1-phenylbutan-2-yl)oxy-7,8-difluoroquinolin-3-amine (PubChem CID 138474823) has the molecular formula C20H18F4N2O and a molecular weight of 378.37 g/mol. Its IUPAC name is N-(4,4-difluoro-2-methyl-1-phenylbutan-2-yl)oxy-7,8-difluoroquinolin-3-amine.
| Compound Name | N-(4,4-difluoro-2-methyl-1-phenylbutan-2-yl)oxy-7,8-difluoroquinolin-3-amine |
|---|---|
| PubChem CID | 138474823 |
| Molecular Formula | C20H18F4N2O |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-(4,4-difluoro-2-methyl-1-phenylbutan-2-yl)oxy-7,8-difluoroquinolin-3-amine |
| SMILES | CC(Cc1ccccc1)(CC(F)F)ONc1cnc2c(F)c(F)ccc2c1 |
| InChI | InChI=1S/C20H18F4N2O/c1-20(11-17(22)23,10-13-5-3-2-4-6-13)27-26-15-9-14-7-8-16(21)18(24)19(14)25-12-15/h2-9,12,17,26H,10-11H2,1H3 |
| InChIKey | ABLNPQHMHLJUPH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|