C23H28N2O — CID 142891302
(Z)-3-[3-tert-butyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]-2-pyridin-2-ylprop-2-enenitrile (PubChem CID 142891302) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (Z)-3-[3-tert-butyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]-2-pyridin-2-ylprop-2-enenitrile.
| Compound Name | (Z)-3-[3-tert-butyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]-2-pyridin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 142891302 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (Z)-3-[3-tert-butyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]-2-pyridin-2-ylprop-2-enenitrile |
| SMILES | CCC(C)(C)c1cc(/C=C(\C#N)c2ccccn2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H28N2O/c1-7-23(5,6)19-14-16(13-18(21(19)26)22(2,3)4)12-17(15-24)20-10-8-9-11-25-20/h8-14,26H,7H2,1-6H3/b17-12+ |
| InChIKey | MOUTUWWHXQRIOX-SFQUDFHCSA-N |
| XLogP | 5.84 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|