C39H39N5O4 — CID 142895243
methyl 5-methyl-4-[(5R)-5-methyl-6-oxo-6-[6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]hexyl]-1H-indole-2-carboxylate (PubChem CID 142895243) has the molecular formula C39H39N5O4 and a molecular weight of 641.77 g/mol. Its IUPAC name is methyl 5-methyl-4-[(5R)-5-methyl-6-oxo-6-[6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]hexyl]-1H-indole-2-carboxylate.
| Compound Name | methyl 5-methyl-4-[(5R)-5-methyl-6-oxo-6-[6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]hexyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142895243 |
| Molecular Formula | C39H39N5O4 |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 641.30 |
| IUPAC Name | methyl 5-methyl-4-[(5R)-5-methyl-6-oxo-6-[6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]hexyl]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(CCCC[C@@H](C)C(=O)c3cc4c5c(ccc4[nH]3)N(C(=O)c3cc4c6c(ccc4[nH]3)NCC6)CC5)c(C)ccc2[nH]1 |
| InChI | InChI=1S/C39H39N5O4/c1-21-8-9-30-26(20-35(43-30)39(47)48-3)23(21)7-5-4-6-22(2)37(45)33-18-28-25-15-17-44(36(25)13-12-32(28)41-33)38(46)34-19-27-24-14-16-40-29(24)10-11-31(27)42-34/h8-13,18-20,22,40-43H,4-7,14-17H2,1-3H3/t22-/m1/s1 |
| InChIKey | SSQVYCBOOGNUNS-JOCHJYFZSA-N |
| XLogP | 7.63 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|