C19H14FNO5 — CID 142897974
2-[2-fluoro-4-[5-(2-methoxy-2-oxoethyl)-1,3-benzoxazol-2-yl]phenyl]prop-2-enoic acid (PubChem CID 142897974) has the molecular formula C19H14FNO5 and a molecular weight of 355.32 g/mol. Its IUPAC name is 2-[2-fluoro-4-[5-(2-methoxy-2-oxoethyl)-1,3-benzoxazol-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | 2-[2-fluoro-4-[5-(2-methoxy-2-oxoethyl)-1,3-benzoxazol-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142897974 |
| Molecular Formula | C19H14FNO5 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[2-fluoro-4-[5-(2-methoxy-2-oxoethyl)-1,3-benzoxazol-2-yl]phenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccc(-c2nc3cc(CC(=O)OC)ccc3o2)cc1F |
| InChI | InChI=1S/C19H14FNO5/c1-10(19(23)24)13-5-4-12(9-14(13)20)18-21-15-7-11(8-17(22)25-2)3-6-16(15)26-18/h3-7,9H,1,8H2,2H3,(H,23,24) |
| InChIKey | IOXYAHZKSZUXGJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|