C19H27N3O3 — CID 142898575
(4-methoxyphenyl)methyl (2R,3S)-3-(3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl)-2,3-diaminopropanoate (PubChem CID 142898575) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2R,3S)-3-(3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl)-2,3-diaminopropanoate.
| Compound Name | (4-methoxyphenyl)methyl (2R,3S)-3-(3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl)-2,3-diaminopropanoate |
|---|---|
| PubChem CID | 142898575 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (4-methoxyphenyl)methyl (2R,3S)-3-(3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl)-2,3-diaminopropanoate |
| SMILES | COc1ccc(COC(=O)[C@H](N)[C@@H](N)C2=CNC3CCCCC23)cc1 |
| InChI | InChI=1S/C19H27N3O3/c1-24-13-8-6-12(7-9-13)11-25-19(23)18(21)17(20)15-10-22-16-5-3-2-4-14(15)16/h6-10,14,16-18,22H,2-5,11,20-21H2,1H3/t14?,16?,17-,18+/m0/s1 |
| InChIKey | VABWADIQLCTYON-DQVOVIAYSA-N |
| XLogP | 1.44 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |