C19H22F3N3O6S — CID 142901853
[6-[3-(2-methoxyethoxymethyl)phenyl]-2-morpholin-4-ylpyrimidin-4-yl] trifluoromethanesulfonate (PubChem CID 142901853) has the molecular formula C19H22F3N3O6S and a molecular weight of 477.46 g/mol. Its IUPAC name is [6-[3-(2-methoxyethoxymethyl)phenyl]-2-morpholin-4-ylpyrimidin-4-yl] trifluoromethanesulfonate.
| Compound Name | [6-[3-(2-methoxyethoxymethyl)phenyl]-2-morpholin-4-ylpyrimidin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142901853 |
| Molecular Formula | C19H22F3N3O6S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | [6-[3-(2-methoxyethoxymethyl)phenyl]-2-morpholin-4-ylpyrimidin-4-yl] trifluoromethanesulfonate |
| SMILES | COCCOCc1cccc(-c2cc(OS(=O)(=O)C(F)(F)F)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C19H22F3N3O6S/c1-28-9-10-30-13-14-3-2-4-15(11-14)16-12-17(31-32(26,27)19(20,21)22)24-18(23-16)25-5-7-29-8-6-25/h2-4,11-12H,5-10,13H2,1H3 |
| InChIKey | QYSQMLAVJBJVAA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|