C14H25F3N2 — CID 142906916
N-(2-methylpropyl)-N-[(E)-5,5,5-trifluoropent-3-enyl]piperidin-4-amine (PubChem CID 142906916) has the molecular formula C14H25F3N2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-[(E)-5,5,5-trifluoropent-3-enyl]piperidin-4-amine.
| Compound Name | N-(2-methylpropyl)-N-[(E)-5,5,5-trifluoropent-3-enyl]piperidin-4-amine |
|---|---|
| PubChem CID | 142906916 |
| Molecular Formula | C14H25F3N2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-(2-methylpropyl)-N-[(E)-5,5,5-trifluoropent-3-enyl]piperidin-4-amine |
| SMILES | CC(C)CN(CC/C=C/C(F)(F)F)C1CCNCC1 |
| InChI | InChI=1S/C14H25F3N2/c1-12(2)11-19(13-5-8-18-9-6-13)10-4-3-7-14(15,16)17/h3,7,12-13,18H,4-6,8-11H2,1-2H3/b7-3+ |
| InChIKey | WCFAIZCFLOCBAX-XVNBXDOJSA-N |
| XLogP | 3.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|