C16H23Cl3N2 — CID 58624363
N-(2-methylpropyl)-N-[(2,3,6-trichlorophenyl)methyl]piperidin-4-amine (PubChem CID 58624363) has the molecular formula C16H23Cl3N2 and a molecular weight of 349.73 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-[(2,3,6-trichlorophenyl)methyl]piperidin-4-amine.
| Compound Name | N-(2-methylpropyl)-N-[(2,3,6-trichlorophenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 58624363 |
| Molecular Formula | C16H23Cl3N2 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-(2-methylpropyl)-N-[(2,3,6-trichlorophenyl)methyl]piperidin-4-amine |
| SMILES | CC(C)CN(Cc1c(Cl)ccc(Cl)c1Cl)C1CCNCC1 |
| InChI | InChI=1S/C16H23Cl3N2/c1-11(2)9-21(12-5-7-20-8-6-12)10-13-14(17)3-4-15(18)16(13)19/h3-4,11-12,20H,5-10H2,1-2H3 |
| InChIKey | FRSABIYIURVDOF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|