C21H27ClF4N2O4 — CID 161190083
(E)-but-2-enedioic acid;N-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methyl]-N-(2-methylpropyl)piperidin-4-amine (PubChem CID 161190083) has the molecular formula C21H27ClF4N2O4 and a molecular weight of 482.90 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methyl]-N-(2-methylpropyl)piperidin-4-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methyl]-N-(2-methylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 161190083 |
| Molecular Formula | C21H27ClF4N2O4 |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]methyl]-N-(2-methylpropyl)piperidin-4-amine |
| SMILES | CC(C)CN(Cc1c(C(F)(F)F)ccc(Cl)c1F)C1CCNCC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H23ClF4N2.C4H4O4/c1-11(2)9-24(12-5-7-23-8-6-12)10-13-14(17(20,21)22)3-4-15(18)16(13)19;5-3(6)1-2-4(7)8/h3-4,11-12,23H,5-10H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | VCVLMPJUEWJDEQ-WLHGVMLRSA-N |
| XLogP | 4.42 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|