C19H32N4O4 — CID 68574938
but-2-enedioic acid;N-[(2,5-dimethylpyrazol-3-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine (PubChem CID 68574938) has the molecular formula C19H32N4O4 and a molecular weight of 380.49 g/mol. Its IUPAC name is but-2-enedioic acid;N-[(2,5-dimethylpyrazol-3-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine.
| Compound Name | but-2-enedioic acid;N-[(2,5-dimethylpyrazol-3-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 68574938 |
| Molecular Formula | C19H32N4O4 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | but-2-enedioic acid;N-[(2,5-dimethylpyrazol-3-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine |
| SMILES | Cc1cc(CN(CC(C)C)C2CCNCC2)n(C)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H28N4.C4H4O4/c1-12(2)10-19(14-5-7-16-8-6-14)11-15-9-13(3)17-18(15)4;5-3(6)1-2-4(7)8/h9,12,14,16H,5-8,10-11H2,1-4H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | JYQADLHRDCEXIY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|