C18H35ClN2 — CID 142906928
N-[2-(1-chloroethenyl)pent-4-enyl]-N-(2-methylpropyl)piperidin-4-amine;ethane (PubChem CID 142906928) has the molecular formula C18H35ClN2 and a molecular weight of 314.95 g/mol. Its IUPAC name is N-[2-(1-chloroethenyl)pent-4-enyl]-N-(2-methylpropyl)piperidin-4-amine;ethane.
| Compound Name | N-[2-(1-chloroethenyl)pent-4-enyl]-N-(2-methylpropyl)piperidin-4-amine;ethane |
|---|---|
| PubChem CID | 142906928 |
| Molecular Formula | C18H35ClN2 |
| Molecular Weight | 314.95 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | N-[2-(1-chloroethenyl)pent-4-enyl]-N-(2-methylpropyl)piperidin-4-amine;ethane |
| SMILES | C=CCC(CN(CC(C)C)C1CCNCC1)C(=C)Cl.CC |
| InChI | InChI=1S/C16H29ClN2.C2H6/c1-5-6-15(14(4)17)12-19(11-13(2)3)16-7-9-18-10-8-16;1-2/h5,13,15-16,18H,1,4,6-12H2,2-3H3;1-2H3 |
| InChIKey | GMUQOPYRONOBDQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.95 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|