C8H14N2S — CID 142907302
4-N-methyl-3-N-propan-2-ylthiophene-3,4-diamine (PubChem CID 142907302) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 4-N-methyl-3-N-propan-2-ylthiophene-3,4-diamine.
| Compound Name | 4-N-methyl-3-N-propan-2-ylthiophene-3,4-diamine |
|---|---|
| PubChem CID | 142907302 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 4-N-methyl-3-N-propan-2-ylthiophene-3,4-diamine |
| SMILES | CNc1cscc1NC(C)C |
| InChI | InChI=1S/C8H14N2S/c1-6(2)10-8-5-11-4-7(8)9-3/h4-6,9-10H,1-3H3 |
| InChIKey | ZRIMMKTVPUMRQZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |