C9H13ClO — CID 142915949
2-chloro-1-ethyl-4-methoxycyclohexa-1,3-diene (PubChem CID 142915949) has the molecular formula C9H13ClO and a molecular weight of 172.66 g/mol. Its IUPAC name is 2-chloro-1-ethyl-4-methoxycyclohexa-1,3-diene.
| Compound Name | 2-chloro-1-ethyl-4-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142915949 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-chloro-1-ethyl-4-methoxycyclohexa-1,3-diene |
| SMILES | CCC1=C(Cl)C=C(OC)CC1 |
| InChI | InChI=1S/C9H13ClO/c1-3-7-4-5-8(11-2)6-9(7)10/h6H,3-5H2,1-2H3 |
| InChIKey | FYLUFWKBFYWCOK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |