C7H9BrO2 — CID 147072342
2-bromo-5-methoxycyclohexa-1,5-dien-1-ol (PubChem CID 147072342) has the molecular formula C7H9BrO2 and a molecular weight of 205.05 g/mol. Its IUPAC name is 2-bromo-5-methoxycyclohexa-1,5-dien-1-ol.
| Compound Name | 2-bromo-5-methoxycyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 147072342 |
| Molecular Formula | C7H9BrO2 |
| Molecular Weight | 205.05 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | 2-bromo-5-methoxycyclohexa-1,5-dien-1-ol |
| SMILES | COC1=CC(O)=C(Br)CC1 |
| InChI | InChI=1S/C7H9BrO2/c1-10-5-2-3-6(8)7(9)4-5/h4,9H,2-3H2,1H3 |
| InChIKey | BFHHIXHGQUMESK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.05 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |