C13H19NO2 — CID 143025790
(2E,6E,8Z)-8-ethylidene-3,6-dimethoxy-N-methylcycloocta-2,6-dien-1-imine (PubChem CID 143025790) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2E,6E,8Z)-8-ethylidene-3,6-dimethoxy-N-methylcycloocta-2,6-dien-1-imine.
| Compound Name | (2E,6E,8Z)-8-ethylidene-3,6-dimethoxy-N-methylcycloocta-2,6-dien-1-imine |
|---|---|
| PubChem CID | 143025790 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2E,6E,8Z)-8-ethylidene-3,6-dimethoxy-N-methylcycloocta-2,6-dien-1-imine |
| SMILES | C/C=C1/C=C(/OC)CC/C(OC)=C\C1=N/C |
| InChI | InChI=1S/C13H19NO2/c1-5-10-8-11(15-3)6-7-12(16-4)9-13(10)14-2/h5,8-9H,6-7H2,1-4H3/b10-5-,11-8+,12-9+,14-13+ |
| InChIKey | WEUFNGULHUYYLM-DGCRZDPTSA-N |
| XLogP | 2.86 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|