C28H15N3O4 — CID 142924847
2-amino-2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4(13),6,8,10,14,19(28),21,23,25,29-dodecaene-5,12,20,27-tetrone (PubChem CID 142924847) has the molecular formula C28H15N3O4 and a molecular weight of 457.45 g/mol. Its IUPAC name is 2-amino-2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4(13),6,8,10,14,19(28),21,23,25,29-dodecaene-5,12,20,27-tetrone.
| Compound Name | 2-amino-2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4(13),6,8,10,14,19(28),21,23,25,29-dodecaene-5,12,20,27-tetrone |
|---|---|
| PubChem CID | 142924847 |
| Molecular Formula | C28H15N3O4 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-amino-2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4(13),6,8,10,14,19(28),21,23,25,29-dodecaene-5,12,20,27-tetrone |
| SMILES | Nn1c2ccc3c(=O)c4ccccc4c(=O)c3c2[nH]c2ccc3c(=O)c4ccccc4c(=O)c3c21 |
| InChI | InChI=1S/C28H15N3O4/c29-31-20-12-10-17-21(27(34)15-7-3-1-5-13(15)25(17)32)23(20)30-19-11-9-18-22(24(19)31)28(35)16-8-4-2-6-14(16)26(18)33/h1-12,30H,29H2 |
| InChIKey | ZZKJGTPBAHUXHQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|