C19H22N7O5S+ — CID 142926695
CID 142926695 (PubChem CID 142926695) has the molecular formula C19H22N7O5S+ and a molecular weight of 460.50 g/mol.
| Compound Name | CID 142926695 |
|---|---|
| PubChem CID | 142926695 |
| Molecular Formula | C19H22N7O5S+ |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | — |
| SMILES | Cc1noc(C2CCN(c3ncnc(Nc4ccc([S+](C)(=O)O)cc4)c3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C19H21N7O5S/c1-12-22-19(31-24-12)13-7-9-25(10-8-13)18-16(26(27)28)17(20-11-21-18)23-14-3-5-15(6-4-14)32(2,29)30/h3-6,11,13H,7-10H2,1-2H3,(H-,20,21,23,29,30)/p+1 |
| InChIKey | XJLRKHHKEZAFRR-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|