C14H26 — CID 142926995
(Z,5Z)-5-ethylidene-6,8-dimethyldec-3-ene (PubChem CID 142926995) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is (Z,5Z)-5-ethylidene-6,8-dimethyldec-3-ene.
| Compound Name | (Z,5Z)-5-ethylidene-6,8-dimethyldec-3-ene |
|---|---|
| PubChem CID | 142926995 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (Z,5Z)-5-ethylidene-6,8-dimethyldec-3-ene |
| SMILES | C/C=C(\C=C/CC)C(C)CC(C)CC |
| InChI | InChI=1S/C14H26/c1-6-9-10-14(8-3)13(5)11-12(4)7-2/h8-10,12-13H,6-7,11H2,1-5H3/b10-9-,14-8+ |
| InChIKey | YJRPSWZFVXJKKA-SIWKXLNPSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|